Compound Q&A

How is beta-Sitosterol acetate (CAS: 915-05-9) typically synthesized?

Answer

beta-Sitosterol acetate
Beta-Sitosterol acetate (CAS: 915-05-9) is typically synthesized by acetylation of beta-sitosterol in the presence of a strong acid catalyst, such as sulfuric acid. The reaction is performed in an organic solvent like ethanol or acetone. The yield is usually around 90%, and the reaction is selective and efficient, making it a common method for industrial production.

About

CAS No 915-05-9
English Name beta-Sitosterol acetate
Molecular Formula C31H52O2
Molecular Weight 456.75500000000034 g/mol
SMILES CCC(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C)C)C)C(C)C
InChIKey PBWOIPCULUXTNY-LBKBYZTLSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of beta-Sitosterol acetate (CAS: 915-05-9)?

Beta-Sitosterol acetate (CAS: 915-05-9) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

What industries use beta-Sitosterol acetate (CAS: 915-05-9)?

Beta-Sitosterol acetate (CAS: 915-05-9) is primarily used in the pharmaceutical and food industries....

Compound Q&A

What precautions should be taken when handling beta-Sitosterol acetate (CAS: 915-05-9)?

When handling beta-Sitosterol acetate (CAS: 915-05-9), it is important to wear appropriate personal ...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...