Compound Q&A

What are the physical and chemical properties of beta-Sitosterol acetate (CAS: 915-05-9)?

Answer

beta-Sitosterol acetate
Beta-Sitosterol acetate (CAS: 915-05-9) is a crystalline compound with a molecular weight of approximately 438.62 g/mol. It has a melting point around 150°C and is sparingly soluble in water but soluble in organic solvents like ethanol and acetone. It is relatively stable under normal conditions but may react with strong bases. This compound is often used in pharmaceutical applications due to its chemical stability and effectiveness.

About

CAS No 915-05-9
English Name beta-Sitosterol acetate
Molecular Formula C31H52O2
Molecular Weight 456.75500000000034 g/mol
SMILES CCC(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C)C)C)C(C)C
InChIKey PBWOIPCULUXTNY-LBKBYZTLSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is beta-Sitosterol acetate (CAS: 915-05-9) typically synthesized?

Beta-Sitosterol acetate (CAS: 915-05-9) is typically synthesized by acetylation of beta-sitosterol i...

Compound Q&A

What industries use beta-Sitosterol acetate (CAS: 915-05-9)?

Beta-Sitosterol acetate (CAS: 915-05-9) is primarily used in the pharmaceutical and food industries....

Compound Q&A

What precautions should be taken when handling beta-Sitosterol acetate (CAS: 915-05-9)?

When handling beta-Sitosterol acetate (CAS: 915-05-9), it is important to wear appropriate personal ...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...