Compound Q&A

What precautions should be taken when handling 1-(4-Fluoro-3-(trifluoromethyl)phenyl)-3-(5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl)urea (CAS: 1430213-30-1)?

Answer

1-(4-Fluoro-3-(trifluoromethyl)phenyl)-3-(5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl)urea
When handling this compound, appropriate personal protective equipment (PPE) should be worn, including gloves, goggles, and lab coats. Ensure proper ventilation in the laboratory and use a fume hood during operations. Spills should be cleaned up immediately using appropriate materials, and the material safety data sheet (MSDS) should be consulted for detailed handling procedures. Avoid contact with skin and eyes, and store the compound under dry conditions away from direct sunlight.

About

English Name 1-(4-Fluoro-3-(trifluoromethyl)phenyl)-3-(5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl)urea
Molecular Formula C15H9F4N5OS
Molecular Weight 383.33 g/mol
SMILES C1=CC(=C(C=C1NC(=O)NC2=NN=C(S2)C3=CC=NC=C3)C(F)(F)F)F
InChIKey WMCOYUSJXXCHFH-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Fluoro-3-(trifluoromethyl)phenyl)-3-(5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl)urea (CAS: 1430213-30-1)?

The compound is crystalline with a molecular weight of approximately 511.92 g/mol. It has a low wate...

Compound Q&A

How is 1-(4-Fluoro-3-(trifluoromethyl)phenyl)-3-(5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl)urea (CAS: 1430213-30-1) typically synthesized?

This compound is typically synthesized via a multi-step process involving the coupling of 4-fluoro-3...

Compound Q&A

What industries use 1-(4-Fluoro-3-(trifluoromethyl)phenyl)-3-(5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl)urea (CAS: 1430213-30-1)?

This compound is primarily used in the pharmaceutical industry due to its potential as a therapeutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...