Compound Q&A

What industries use 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1)?

Answer

4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide
4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1) is used in the pharmaceutical industry for the synthesis of drug precursors and intermediates. It also has potential applications in the polymer industry, where it can be used as a modifier or additive. Additionally, this compound may be utilized in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide
Molecular Formula C11H17NO3
Molecular Weight 211.26 g/mol
SMILES CC1=C(C=C[N+](=C1C)[O-])OCCCOC
InChIKey NZQKWDSCDLYKDF-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1)?

4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1) is a crystalline solid with a m...

Compound Q&A

How is 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1) typically synthesized?

4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1) is commonly synthesized via the...

Compound Q&A

What precautions should be taken when handling 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1)?

When handling 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1), appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...