Compound Q&A

What are the physical and chemical properties of 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1)?

Answer

4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide
4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1) is a crystalline solid with a molecular weight of approximately 275.34 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and dichloromethane. The compound is moderately reactive, particularly under basic conditions. It can react with nucleophiles and undergoes ring-opening reactions with certain reagents.

About

English Name 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide
Molecular Formula C11H17NO3
Molecular Weight 211.26 g/mol
SMILES CC1=C(C=C[N+](=C1C)[O-])OCCCOC
InChIKey NZQKWDSCDLYKDF-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1) typically synthesized?

4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1) is commonly synthesized via the...

Compound Q&A

What industries use 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1)?

4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1) is used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1)?

When handling 4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide (CAS: 117977-18-1), appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...