Compound Q&A

What precautions should be taken when handling 4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1)?

Answer

4-(4-Ethylcyclohexyl)benzonitrile
When handling 4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1), use appropriate personal protective equipment (PPE) such as gloves and safety glasses. Store the compound in a well-ventilated area away from heat and sources of ignition. Work in a fume hood during synthesis and use proper spill cleanup procedures. Always refer to the Safety Data Sheet (SDS) for detailed information on handling and disposal. Ensure that all containers are properly labeled and stored in a secure location to prevent accidental exposure or contamination.

About

CAS No 73592-81-1
English Name 4-(4-Ethylcyclohexyl)benzonitrile
Molecular Formula C15H19N
Molecular Weight 17.03 g/mol
SMILES CCC1CCC(CC1)C2=CC=C(C=C2)C#N
InChIKey BBHJTCADCKZYSO-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1)?

4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1) is a colorless to white crystalline solid. It ha...

Compound Q&A

How is 4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1) typically synthesized?

4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1) is typically synthesized via a Friedel-Crafts al...

Compound Q&A

What industries use 4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1)?

4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1) is primarily used in the pharmaceutical industry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...