Compound Q&A

What are the physical and chemical properties of 4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1)?

Answer

4-(4-Ethylcyclohexyl)benzonitrile
4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1) is a colorless to white crystalline solid. It has a molecular weight of approximately 210.21 g/mol and a melting point of 58-60°C. This compound is slightly soluble in water but readily soluble in organic solvents such as ethanol and dichloromethane. It is relatively stable under normal conditions but can undergo hydrolysis in the presence of strong acids or bases. Its chemical reactivity is low, but it can undergo electrophilic aromatic substitution reactions.

About

CAS No 73592-81-1
English Name 4-(4-Ethylcyclohexyl)benzonitrile
Molecular Formula C15H19N
Molecular Weight 17.03 g/mol
SMILES CCC1CCC(CC1)C2=CC=C(C=C2)C#N
InChIKey BBHJTCADCKZYSO-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1) typically synthesized?

4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1) is typically synthesized via a Friedel-Crafts al...

Compound Q&A

What industries use 4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1)?

4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1)?

When handling 4-(4-Ethylcyclohexyl)benzonitrile (CAS: 73592-81-1), use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...