Compound Q&A

What precautions should be taken when handling 3-Bromo-N,N-bis(4-methylphenyl)aniline (CAS: 845526-91-2)?

Answer

3-Bromo-N,N-bis(4-methylphenyl)aniline
When handling 3-Bromo-N,N-bis(4-methylphenyl)aniline (CAS: 845526-91-2), it is important to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a cool, dry place to prevent degradation. Spills should be cleaned up using absorbent materials, and the area should be well-ventilated. Always refer to the safety data sheet (SDS) for detailed handling and storage guidelines to ensure safety in the laboratory environment.

About

English Name 3-Bromo-N,N-bis(4-methylphenyl)aniline
Molecular Formula C20H18BrN
Molecular Weight 352.28 g/mol
SMILES CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=CC(=CC=C3)Br
InChIKey LBLFZUNRAGUAFR-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-N,N-bis(4-methylphenyl)aniline (CAS: 845526-91-2)?

3-Bromo-N,N-bis(4-methylphenyl)aniline (CAS: 845526-91-2) is a solid, crystalline compound with a mo...

Compound Q&A

How is 3-Bromo-N,N-bis(4-methylphenyl)aniline (CAS: 845526-91-2) typically synthesized?

3-Bromo-N,N-bis(4-methylphenyl)aniline (CAS: 845526-91-2) is typically synthesized via a series of r...

Compound Q&A

What industries use 3-Bromo-N,N-bis(4-methylphenyl)aniline (CAS: 845526-91-2)?

3-Bromo-N,N-bis(4-methylphenyl)aniline (CAS: 845526-91-2) is used in various industries. Its applica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...