Compound Q&A

How is 9,10-Anthracenedicarboxylic acid (CAS: 73016-08-7) typically synthesized?

Answer

9,10-Anthracenedicarboxylic acid
9,10-Anthracenedicarboxylic acid can be synthesized via the Wittig reaction, where anthracene is treated with phosphorus ylide and a strong base like n-butyllithium. Another method involves the oxidative cleavage of anthracene-9,10-dione using hydrogen peroxide in the presence of a catalyst like manganese dioxide. These processes typically yield high selectivity and good to excellent yields.

About

CAS No 73016-08-7
English Name 9,10-Anthracenedicarboxylic acid
Molecular Formula C16H10O4
Molecular Weight 266.25 g/mol
SMILES O=C(O)C1=C2C=CC=CC2=C(C3=CC=CC=C13)C(O)=O
InChIKey FDFGHPKPHFUHBP-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9,10-Anthracenedicarboxylic acid (CAS: 73016-08-7)?

9,10-Anthracenedicarboxylic acid is a white crystalline solid with a molecular weight of approximate...

Compound Q&A

What industries use 9,10-Anthracenedicarboxylic acid (CAS: 73016-08-7)?

9,10-Anthracenedicarboxylic acid is primarily used in the production of polyesters, as a monomer for...

Compound Q&A

What precautions should be taken when handling 9,10-Anthracenedicarboxylic acid (CAS: 73016-08-7)?

When handling 9,10-Anthracenedicarboxylic acid, laboratory personnel should wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...