Compound Q&A

What are the physical and chemical properties of 9,10-Anthracenedicarboxylic acid (CAS: 73016-08-7)?

Answer

9,10-Anthracenedicarboxylic acid
9,10-Anthracenedicarboxylic acid is a white crystalline solid with a molecular weight of approximately 244.24 g/mol. It has a high solubility in hot water and poor solubility in cold water. The acid is known for its strong reactivity, particularly towards nucleophilic substitution and condensation reactions. It is highly stable in dry air but can decompose in the presence of moisture and heat.

About

CAS No 73016-08-7
English Name 9,10-Anthracenedicarboxylic acid
Molecular Formula C16H10O4
Molecular Weight 266.25 g/mol
SMILES O=C(O)C1=C2C=CC=CC2=C(C3=CC=CC=C13)C(O)=O
InChIKey FDFGHPKPHFUHBP-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 9,10-Anthracenedicarboxylic acid (CAS: 73016-08-7) typically synthesized?

9,10-Anthracenedicarboxylic acid can be synthesized via the Wittig reaction, where anthracene is tre...

Compound Q&A

What industries use 9,10-Anthracenedicarboxylic acid (CAS: 73016-08-7)?

9,10-Anthracenedicarboxylic acid is primarily used in the production of polyesters, as a monomer for...

Compound Q&A

What precautions should be taken when handling 9,10-Anthracenedicarboxylic acid (CAS: 73016-08-7)?

When handling 9,10-Anthracenedicarboxylic acid, laboratory personnel should wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...