Compound Q&A

What industries use p-Hydroxy-5,6-dehydrokawain (CAS: 39986-86-2)?

Answer

p-Hydroxy-5,6-dehydrokawain
p-Hydroxy-5,6-dehydrokawain is used in the pharmaceutical industry for the development of certain drug candidates. It is also utilized in the production of certain polymers and as a precursor in the synthesis of other chemical compounds. Additionally, it has applications in the development of advanced sensor technologies.

About

CAS No 39986-86-2
English Name p-Hydroxy-5,6-dehydrokawain
Molecular Formula C14H12O4
Molecular Weight 244.24 g/mol
SMILES COc1cc(/C=C/c2ccc(cc2)O)oc(=O)c1
InChIKey VWYHYOYHRIWSJU-QPJJXVBHSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of p-Hydroxy-5,6-dehydrokawain (CAS: 39986-86-2)?

p-Hydroxy-5,6-dehydrokawain is a white crystalline powder with a molecular weight of approximately 2...

Compound Q&A

How is p-Hydroxy-5,6-dehydrokawain (CAS: 39986-86-2) typically synthesized?

p-Hydroxy-5,6-dehydrokawain can be synthesized through a multi-step process involving the dehydrogen...

Compound Q&A

What precautions should be taken when handling p-Hydroxy-5,6-dehydrokawain (CAS: 39986-86-2)?

When handling p-Hydroxy-5,6-dehydrokawain, appropriate personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...