Compound Q&A

What are the physical and chemical properties of p-Hydroxy-5,6-dehydrokawain (CAS: 39986-86-2)?

Answer

p-Hydroxy-5,6-dehydrokawain
p-Hydroxy-5,6-dehydrokawain is a white crystalline powder with a molecular weight of approximately 252.21 g/mol. It has good solubility in water and is slightly soluble in ethanol. It is stable under acidic and neutral conditions but can undergo hydrolysis under basic conditions. The compound exhibits moderate reactivity with nucleophiles and is susceptible to oxidation.

About

CAS No 39986-86-2
English Name p-Hydroxy-5,6-dehydrokawain
Molecular Formula C14H12O4
Molecular Weight 244.24 g/mol
SMILES COc1cc(/C=C/c2ccc(cc2)O)oc(=O)c1
InChIKey VWYHYOYHRIWSJU-QPJJXVBHSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is p-Hydroxy-5,6-dehydrokawain (CAS: 39986-86-2) typically synthesized?

p-Hydroxy-5,6-dehydrokawain can be synthesized through a multi-step process involving the dehydrogen...

Compound Q&A

What industries use p-Hydroxy-5,6-dehydrokawain (CAS: 39986-86-2)?

p-Hydroxy-5,6-dehydrokawain is used in the pharmaceutical industry for the development of certain dr...

Compound Q&A

What precautions should be taken when handling p-Hydroxy-5,6-dehydrokawain (CAS: 39986-86-2)?

When handling p-Hydroxy-5,6-dehydrokawain, appropriate personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...