Compound Q&A

How is 2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5) typically synthesized?

Answer

2,4-Difluoro-5-nitrophenol
2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5) is commonly synthesized via the nitration of 2,4-difluorophenol using concentrated nitric acid and sulfuric acid as the nitrating agent. The reaction is typically carried out under reflux conditions, and the product is purified by recrystallization. Catalysts like FeSO4 are often used to improve the selectivity and yield of the nitration step.

About

English Name 2,4-Difluoro-5-nitrophenol
Molecular Formula C6H3F2NO3
Molecular Weight 175.09 g/mol
SMILES Oc1cc([N+](=O)[O-])c(F)cc1F
InChIKey SMRYCTJAGPDVEH-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5)?

2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5) is a crystalline solid with a molecular weight of 212....

Compound Q&A

What industries use 2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5)?

2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5) is used in the pharmaceutical industry for the synthes...

Compound Q&A

What precautions should be taken when handling 2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5)?

When handling 2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5), safety goggles and gloves must be worn....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...