Compound Q&A

What are the physical and chemical properties of 2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5)?

Answer

2,4-Difluoro-5-nitrophenol
2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5) is a crystalline solid with a molecular weight of 212.05 g/mol. It has a high solubility in organic solvents like dichloromethane and acetone. Chemically, it is highly reactive, showing reactivity towards nucleophiles and reducing agents. It is also unstable in strong bases and light exposure, leading to decomposition.

About

English Name 2,4-Difluoro-5-nitrophenol
Molecular Formula C6H3F2NO3
Molecular Weight 175.09 g/mol
SMILES Oc1cc([N+](=O)[O-])c(F)cc1F
InChIKey SMRYCTJAGPDVEH-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5) typically synthesized?

2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5) is commonly synthesized via the nitration of 2,4-diflu...

Compound Q&A

What industries use 2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5)?

2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5) is used in the pharmaceutical industry for the synthes...

Compound Q&A

What precautions should be taken when handling 2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5)?

When handling 2,4-Difluoro-5-nitrophenol (CAS: 113512-57-5), safety goggles and gloves must be worn....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...