Compound Q&A

What are the physical and chemical properties of Pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alaninate (CAS: 125043-04-1)?

Answer

Pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alaninate
Pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alaninate is a crystalline compound with a molecular weight of approximately 589.7 g/mol. It has low solubility in water but is soluble in organic solvents. The compound is highly reactive due to the presence of the pentafluorophenyl group and the fluorenylmethoxy carbonyl moiety, which makes it useful in various chemical reactions.

About

English Name Pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alaninate
Molecular Formula C24H16F5NO4
Molecular Weight 477.39 g/mol
SMILES CC(C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
InChIKey CJXZXBGKOSXBFR-LLVKDONJSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is Pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alaninate (CAS: 125043-04-1) typically synthesized?

Pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alaninate is typically synthesized through ...

Compound Q&A

What industries use Pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alaninate (CAS: 125043-04-1)?

Pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alaninate is used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alaninate (CAS: 125043-04-1)?

When handling this compound, it is important to wear personal protective equipment (PPE) such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...