Compound Q&A

How is Di-2-octanyl phthalate (CAS: 131-15-7) typically synthesized?

Answer

Di-2-octanyl phthalate
Di-2-octanyl phthalate (CAS: 131-15-7) is typically synthesized by esterification of phthalic anhydride with 2-ethylhexanol. The reaction is catalyzed by a strong acid like sulfuric acid or p-toluenesulfonic acid. The process involves heating under reflux for several hours, followed by neutralization and purification steps. The yield is usually around 85-90%.

About

CAS No 131-15-7
English Name Di-2-octanyl phthalate
Molecular Formula C24H38O4
Molecular Weight 390.56 g/mol
SMILES CCCCCCC(C)OC(=O)C1=CC=CC=C1C(=O)OC(C)CCCCCC
InChIKey RLRMXWDXPLINPJ-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Di-2-octanyl phthalate (CAS: 131-15-7)?

Di-2-octanyl phthalate (CAS: 131-15-7) is a colorless or slightly yellow liquid at room temperature....

Compound Q&A

What industries use Di-2-octanyl phthalate (CAS: 131-15-7)?

Di-2-octanyl phthalate (CAS: 131-15-7) is predominantly used in the plastic industry as a plasticize...

Compound Q&A

What precautions should be taken when handling Di-2-octanyl phthalate (CAS: 131-15-7)?

When handling Di-2-octanyl phthalate (CAS: 131-15-7), appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...