Compound Q&A

What are the physical and chemical properties of Di-2-octanyl phthalate (CAS: 131-15-7)?

Answer

Di-2-octanyl phthalate
Di-2-octanyl phthalate (CAS: 131-15-7) is a colorless or slightly yellow liquid at room temperature. It has a molecular weight of approximately 394.47 g/mol and a melting point of about -17°C. This compound is slightly soluble in water but highly soluble in organic solvents. It is reactive towards bases and exhibits some ester hydrolysis. The compound is used in various applications, including plasticizers and coatings.

About

CAS No 131-15-7
English Name Di-2-octanyl phthalate
Molecular Formula C24H38O4
Molecular Weight 390.56 g/mol
SMILES CCCCCCC(C)OC(=O)C1=CC=CC=C1C(=O)OC(C)CCCCCC
InChIKey RLRMXWDXPLINPJ-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is Di-2-octanyl phthalate (CAS: 131-15-7) typically synthesized?

Di-2-octanyl phthalate (CAS: 131-15-7) is typically synthesized by esterification of phthalic anhydr...

Compound Q&A

What industries use Di-2-octanyl phthalate (CAS: 131-15-7)?

Di-2-octanyl phthalate (CAS: 131-15-7) is predominantly used in the plastic industry as a plasticize...

Compound Q&A

What precautions should be taken when handling Di-2-octanyl phthalate (CAS: 131-15-7)?

When handling Di-2-octanyl phthalate (CAS: 131-15-7), appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...