Compound Q&A

What industries use Diphenyliodonium bromide (CAS: 1483-73-4)?

Answer

Diphenyliodonium bromide
Diphenyliodonium bromide is used in the pharmaceutical industry for the synthesis of various drug molecules. It is also utilized in the polymer industry for the preparation of functionalized polymers and in the semiconductor industry for the development of novel materials. Additionally, it has applications in sensor technology for detecting specific chemical species.

About

CAS No 1483-73-4
English Name Diphenyliodonium bromide
Molecular Formula C12H10BrI
Molecular Weight 361.02 g/mol
SMILES C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Br-]
InChIKey LGPSGXJFQQZYMS-UHFFFAOYSA-M
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diphenyliodonium bromide (CAS: 1483-73-4)?

Diphenyliodonium bromide is a white crystalline solid with a molecular weight of approximately 268.2...

Compound Q&A

How is Diphenyliodonium bromide (CAS: 1483-73-4) typically synthesized?

Diphenyliodonium bromide is typically synthesized by the reaction of phenyllithium with iodobenzene ...

Compound Q&A

What precautions should be taken when handling Diphenyliodonium bromide (CAS: 1483-73-4)?

When handling Diphenyliodonium bromide, it is important to wear chemical splash goggles and appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...