Compound Q&A

How is Diphenyliodonium bromide (CAS: 1483-73-4) typically synthesized?

Answer

Diphenyliodonium bromide
Diphenyliodonium bromide is typically synthesized by the reaction of phenyllithium with iodobenzene in a non-polar solvent like toluene. The reaction yields a mixture of isomers, with the desired product being isolated by recrystallization from an appropriate solvent. This process requires careful control of temperature and solvent to achieve the desired yield and purity.

About

CAS No 1483-73-4
English Name Diphenyliodonium bromide
Molecular Formula C12H10BrI
Molecular Weight 361.02 g/mol
SMILES C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Br-]
InChIKey LGPSGXJFQQZYMS-UHFFFAOYSA-M
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diphenyliodonium bromide (CAS: 1483-73-4)?

Diphenyliodonium bromide is a white crystalline solid with a molecular weight of approximately 268.2...

Compound Q&A

What industries use Diphenyliodonium bromide (CAS: 1483-73-4)?

Diphenyliodonium bromide is used in the pharmaceutical industry for the synthesis of various drug mo...

Compound Q&A

What precautions should be taken when handling Diphenyliodonium bromide (CAS: 1483-73-4)?

When handling Diphenyliodonium bromide, it is important to wear chemical splash goggles and appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...