Compound Q&A

What industries use 4-Chloro-3,5-difluorobenzoic acid (CAS: 1160573-19-2)?

Answer

4-Chloro-3,5-difluorobenzoic acid
4-Chloro-3,5-difluorobenzoic acid is used in various industries, particularly in the pharmaceuticals and fine chemicals sector for the synthesis of intermediates and active pharmaceutical ingredients. It also finds application in the agrochemical industry, where it can be used in the development of herbicides and pesticides. Additionally, it is utilized in the production of polymers and sensors due to its chemical properties.

About

English Name 4-Chloro-3,5-difluorobenzoic acid
Molecular Formula C7H3ClF2O2
Molecular Weight 192.548 g/mol
SMILES C1=C(C=C(C(=C1F)Cl)F)C(=O)O
InChIKey PVIHLHXXVCVGTP-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-3,5-difluorobenzoic acid (CAS: 1160573-19-2)?

4-Chloro-3,5-difluorobenzoic acid is a solid crystalline compound with a molecular weight of approxi...

Compound Q&A

How is 4-Chloro-3,5-difluorobenzoic acid (CAS: 1160573-19-2) typically synthesized?

4-Chloro-3,5-difluorobenzoic acid can be synthesized via the Friedel-Crafts alkylation of 3,5-difluo...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3,5-difluorobenzoic acid (CAS: 1160573-19-2)?

When handling 4-Chloro-3,5-difluorobenzoic acid, safety gloves and goggles should be worn. It is adv...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...