Compound Q&A

What are the physical and chemical properties of 4-Chloro-3,5-difluorobenzoic acid (CAS: 1160573-19-2)?

Answer

4-Chloro-3,5-difluorobenzoic acid
4-Chloro-3,5-difluorobenzoic acid is a solid crystalline compound with a molecular weight of approximately 228.01 g/mol. It has a melting point of 180-182°C and is slightly soluble in water. Chemically, it is less reactive than other aromatic carboxylic acids but can undergo typical carboxylic acid reactions such as esterification, amide formation, and reduction. It is stable under normal storage conditions but should be protected from moisture.

About

English Name 4-Chloro-3,5-difluorobenzoic acid
Molecular Formula C7H3ClF2O2
Molecular Weight 192.548 g/mol
SMILES C1=C(C=C(C(=C1F)Cl)F)C(=O)O
InChIKey PVIHLHXXVCVGTP-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 4-Chloro-3,5-difluorobenzoic acid (CAS: 1160573-19-2) typically synthesized?

4-Chloro-3,5-difluorobenzoic acid can be synthesized via the Friedel-Crafts alkylation of 3,5-difluo...

Compound Q&A

What industries use 4-Chloro-3,5-difluorobenzoic acid (CAS: 1160573-19-2)?

4-Chloro-3,5-difluorobenzoic acid is used in various industries, particularly in the pharmaceuticals...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3,5-difluorobenzoic acid (CAS: 1160573-19-2)?

When handling 4-Chloro-3,5-difluorobenzoic acid, safety gloves and goggles should be worn. It is adv...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...