Compound Q&A

What industries use 5-{[5-(4-Fluorophenyl)-2-furyl]methylene}-1,3-thiazolidine-2,4-dione (CAS: 1218777-13-9)?

Answer

5-{[5-(4-Fluorophenyl)-2-furyl]methylene}-1,3-thiazolidine-2,4-dione
5-{[5-(4-Fluorophenyl)-2-furyl]methylene}-1,3-thiazolidine-2,4-dione is used in the pharmaceutical industry for its potential as an intermediate in the synthesis of medicinal compounds. It may also find applications in the polymer industry for its ability to enhance certain properties of polymers. Additionally, it can be utilized in the development of sensors and semiconductors due to its unique chemical structure.

About

English Name 5-{[5-(4-Fluorophenyl)-2-furyl]methylene}-1,3-thiazolidine-2,4-dione
Molecular Formula C14H8FNO3S
Molecular Weight 289.29 g/mol
SMILES O=C1SC(=Cc2ccc(o2)c2ccc(cc2)F)C(=O)N1
InChIKey UFBTYTGRUBUUIL-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-{[5-(4-Fluorophenyl)-2-furyl]methylene}-1,3-thiazolidine-2,4-dione (CAS: 1218777-13-9)?

5-{[5-(4-Fluorophenyl)-2-furyl]methylene}-1,3-thiazolidine-2,4-dione is a crystalline solid with a m...

Compound Q&A

How is 5-{[5-(4-Fluorophenyl)-2-furyl]methylene}-1,3-thiazolidine-2,4-dione (CAS: 1218777-13-9) typically synthesized?

5-{[5-(4-Fluorophenyl)-2-furyl]methylene}-1,3-thiazolidine-2,4-dione is synthesized using a multi-st...

Compound Q&A

What precautions should be taken when handling 5-{[5-(4-Fluorophenyl)-2-furyl]methylene}-1,3-thiazolidine-2,4-dione (CAS: 1218777-13-9)?

When handling 5-{[5-(4-Fluorophenyl)-2-furyl]methylene}-1,3-thiazolidine-2,4-dione, it is important ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...