Compound Q&A

What industries use 3-Bromo-6-nitroquinoline (CAS: 7101-95-3)?

Answer

3-Bromo-6-nitroquinoline
3-Bromo-6-nitroquinoline (CAS: 7101-95-3) is primarily used in the pharmaceutical industry for the synthesis of drug intermediates. It also finds applications in the polymer industry for certain polymer modifications and in the development of sensors and semiconductors due to its electronic properties.

About

CAS No 7101-95-3
English Name 3-Bromo-6-nitroquinoline
Molecular Formula C9H5BrN2O2
Molecular Weight 253.05 g/mol
SMILES C1=CC2=NC=C(C=C2C=C1[N+](=O)[O-])Br
InChIKey XIGQUURJVUSYBF-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-6-nitroquinoline (CAS: 7101-95-3)?

3-Bromo-6-nitroquinoline (CAS: 7101-95-3) is a crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 3-Bromo-6-nitroquinoline (CAS: 7101-95-3) typically synthesized?

3-Bromo-6-nitroquinoline (CAS: 7101-95-3) can be synthesized via a multi-step process. Commonly, sta...

Compound Q&A

What precautions should be taken when handling 3-Bromo-6-nitroquinoline (CAS: 7101-95-3)?

When handling 3-Bromo-6-nitroquinoline (CAS: 7101-95-3), it is crucial to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...