Compound Q&A

How is 3-Bromo-6-nitroquinoline (CAS: 7101-95-3) typically synthesized?

Answer

3-Bromo-6-nitroquinoline
3-Bromo-6-nitroquinoline (CAS: 7101-95-3) can be synthesized via a multi-step process. Commonly, starting from 6-nitroquinoline, bromination is performed using N-bromosuccinimide (NBS) in the presence of a radical initiator like AIBN. The reaction typically yields a high yield with good selectivity towards the bromo substitution.

About

CAS No 7101-95-3
English Name 3-Bromo-6-nitroquinoline
Molecular Formula C9H5BrN2O2
Molecular Weight 253.05 g/mol
SMILES C1=CC2=NC=C(C=C2C=C1[N+](=O)[O-])Br
InChIKey XIGQUURJVUSYBF-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-6-nitroquinoline (CAS: 7101-95-3)?

3-Bromo-6-nitroquinoline (CAS: 7101-95-3) is a crystalline solid with a molecular weight of approxim...

Compound Q&A

What industries use 3-Bromo-6-nitroquinoline (CAS: 7101-95-3)?

3-Bromo-6-nitroquinoline (CAS: 7101-95-3) is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 3-Bromo-6-nitroquinoline (CAS: 7101-95-3)?

When handling 3-Bromo-6-nitroquinoline (CAS: 7101-95-3), it is crucial to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...