Compound Q&A

What precautions should be taken when handling 3,5-Bis(trifluoromethyl)phenylhydrazine (CAS: 886-35-1)?

Answer

3,5-Bis(trifluoromethyl)phenylhydrazine
When handling 3,5-Bis(trifluoromethyl)phenylhydrazine, it is crucial to use personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be handled with appropriate absorbent materials and disposed of according to local hazardous waste regulations. Safety data sheets (SDS) should be consulted for detailed handling and disposal instructions.

About

CAS No 886-35-1
English Name 3,5-Bis(trifluoromethyl)phenylhydrazine
Molecular Formula C8H6F6N2
Molecular Weight 244.14 g/mol
SMILES C1=C(C=C(C=C1C(F)(F)F)NN)C(F)(F)F
InChIKey OULWACKZBGBRNT-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Bis(trifluoromethyl)phenylhydrazine (CAS: 886-35-1)?

3,5-Bis(trifluoromethyl)phenylhydrazine is a crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 3,5-Bis(trifluoromethyl)phenylhydrazine (CAS: 886-35-1) typically synthesized?

3,5-Bis(trifluoromethyl)phenylhydrazine is typically synthesized through the reduction of 3,5-bis(tr...

Compound Q&A

What industries use 3,5-Bis(trifluoromethyl)phenylhydrazine (CAS: 886-35-1)?

3,5-Bis(trifluoromethyl)phenylhydrazine is used in various industries, particularly in the pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...