Compound Q&A

What precautions should be taken when handling (3R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinecarboxylic acid (CAS: 193693-67-3)?

Answer

(3R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinecarboxylic acid
When handling (3R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinecarboxylic acid, it is essential to use appropriate personal protective equipment (PPE) such as gloves, safety glasses, and lab coat. This compound should be handled in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately with appropriate absorbent materials, and the area should be flushed with water. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name (3R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinecarboxylic acid
Molecular Formula C21H21NO4
Molecular Weight 351.4 g/mol
SMILES C1CC(CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O
InChIKey FINXGQXNIBNREL-CQSZACIVSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinecarboxylic acid (CAS: 193693-67-3)?

(3R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinecarboxylic acid is a white crystalline solid w...

Compound Q&A

How is (3R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinecarboxylic acid (CAS: 193693-67-3) typically synthesized?

(3R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinecarboxylic acid can be synthesized via the cou...

Compound Q&A

What industries use (3R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinecarboxylic acid (CAS: 193693-67-3)?

(3R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinecarboxylic acid is primarily used in pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...