Compound Q&A

How is 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2) typically synthesized?

Answer

4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide
4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide is typically synthesized by the nitration of 2,2'-bipyridine using nitric acid and sulfuric acid as the nitrating agents. The process requires careful control of temperature and reaction time to achieve the desired yield and selectivity. Proper safety precautions, including the use of a fume hood, should be followed during the synthesis.

About

CAS No 51595-55-2
English Name 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide
Molecular Formula C10H6N4O6
Molecular Weight 278.18 g/mol
SMILES C1=CN(C(=C2C=C(C=C[N+]2=O)[N+](=O)[O-])C=C1[N+](=O)[O-])[O-]
InChIKey QVRTYCMSRZUOJO-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2)?

4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2) is a crystalline solid with a molecula...

Compound Q&A

What industries use 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2)?

4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2) is used in various industries, includi...

Compound Q&A

What precautions should be taken when handling 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2)?

When handling 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...