Compound Q&A

What are the physical and chemical properties of 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2)?

Answer

4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide
4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2) is a crystalline solid with a molecular weight of approximately 336.07 g/mol. It has limited solubility in water but is more soluble in organic solvents. The compound is known for its high reactivity, particularly with reducing agents and metals. It exhibits significant fluorescence, which makes it useful in spectroscopic applications.

About

CAS No 51595-55-2
English Name 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide
Molecular Formula C10H6N4O6
Molecular Weight 278.18 g/mol
SMILES C1=CN(C(=C2C=C(C=C[N+]2=O)[N+](=O)[O-])C=C1[N+](=O)[O-])[O-]
InChIKey QVRTYCMSRZUOJO-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2) typically synthesized?

4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide is typically synthesized by the nitration of 2,2'-bipyri...

Compound Q&A

What industries use 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2)?

4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2) is used in various industries, includi...

Compound Q&A

What precautions should be taken when handling 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2)?

When handling 4,4'-Dinitro-[2,2'-bipyridine] 1,1'-dioxide (CAS: 51595-55-2), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...