Compound Q&A

What industries use 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2)?

Answer

2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid
2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the agricultural sector as part of herbicide formulations. Additionally, this compound may find applications in polymer science and as a reagent in analytical chemistry for its specific functional groups.

About

CAS No 40843-25-2
English Name 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid
Molecular Formula C15H12Cl2O4
Molecular Weight 327.16 g/mol
SMILES CC(C(=O)O)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)Cl
InChIKey OOLBCHYXZDXLDS-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2)?

2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2) is a white crystalline solid with...

Compound Q&A

How is 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2) typically synthesized?

2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2) is typically synthesized via a mu...

Compound Q&A

What precautions should be taken when handling 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2)?

When handling 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2), it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...