Compound Q&A

What are the physical and chemical properties of 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2)?

Answer

2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid
2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2) is a white crystalline solid with a molecular weight of approximately 396.03 g/mol. It has a melting point of about 127-128°C and is slightly soluble in water. This compound is not highly reactive but can undergo acid-catalyzed esterification reactions. It is often used in chemical synthesis due to its stability and specific functional groups.

About

CAS No 40843-25-2
English Name 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid
Molecular Formula C15H12Cl2O4
Molecular Weight 327.16 g/mol
SMILES CC(C(=O)O)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)Cl
InChIKey OOLBCHYXZDXLDS-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2) typically synthesized?

2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2) is typically synthesized via a mu...

Compound Q&A

What industries use 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2)?

2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2) is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2)?

When handling 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (CAS: 40843-25-2), it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...