Compound Q&A

What are the physical and chemical properties of 2-[(1R)-3-(Diisopropylamino)-1-phenylpropyl]-4-methylphenol hydrobromide (CAS: 837376-36-0)?

Answer

2-[(1R)-3-(Diisopropylamino)-1-phenylpropyl]-4-methylphenol hydrobromide (1:1)
2-[(1R)-3-(Diisopropylamino)-1-phenylpropyl]-4-methylphenol hydrobromide (CAS: 837376-36-0) is a solid that crystallizes in the form of needles. Its molecular weight is approximately 520.62 g/mol. The compound is moderately soluble in water and ethanol. It exhibits reactivity towards basic conditions and undergoes hydrolysis. The compound is stable under normal conditions but should be stored in a dry, cool place away from moisture and heat sources.

About

English Name 2-[(1R)-3-(Diisopropylamino)-1-phenylpropyl]-4-methylphenol hydrobromide (1:1)
Molecular Formula C22H32BrNO
Molecular Weight 406.41 g/mol
SMILES CC1=CC(=C(C=C1)O)C(CCN(C(C)C)C(C)C)C2=CC=CC=C2.Br
InChIKey ZMIOHGDJVPQTCH-VEIFNGETSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 2-[(1R)-3-(Diisopropylamino)-1-phenylpropyl]-4-methylphenol hydrobromide (CAS: 837376-36-0) typically synthesized?

2-[(1R)-3-(Diisopropylamino)-1-phenylpropyl]-4-methylphenol hydrobromide (CAS: 837376-36-0) is typic...

Compound Q&A

What industries use 2-[(1R)-3-(Diisopropylamino)-1-phenylpropyl]-4-methylphenol hydrobromide (CAS: 837376-36-0)?

2-[(1R)-3-(Diisopropylamino)-1-phenylpropyl]-4-methylphenol hydrobromide (CAS: 837376-36-0) is prima...

Compound Q&A

What precautions should be taken when handling 2-[(1R)-3-(Diisopropylamino)-1-phenylpropyl]-4-methylphenol hydrobromide (CAS: 837376-36-0)?

When handling 2-[(1R)-3-(Diisopropylamino)-1-phenylpropyl]-4-methylphenol hydrobromide (CAS: 837376-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...