Compound Q&A

What industries use Benzyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 315718-05-9)?

Answer

Benzyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate
Benzyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 315718-05-9) is used in various industries, including pharmaceuticals, where it serves as a precursor for drug intermediates. It is also utilized in the polymer industry for the synthesis of functionalized polymers and in the production of sensors for detecting specific chemical species. Additionally, it finds applications in the semiconductor industry as a precursor for preparing certain organic semiconductors.

About

English Name Benzyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate
Molecular Formula C13H17NO3
Molecular Weight 235.28 g/mol
SMILES C1CN(CC1CO)C(=O)OCC2=CC=CC=C2
InChIKey ZRMWRJLLAVAFQP-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 315718-05-9)?

Benzyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 315718-05-9) is a white crystalline solid wi...

Compound Q&A

How is Benzyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 315718-05-9) typically synthesized?

Benzyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 315718-05-9) can be synthesized via the cond...

Compound Q&A

What precautions should be taken when handling Benzyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 315718-05-9)?

When handling Benzyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 315718-05-9), it is important ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...