Compound Q&A

How is 5-Nitro-1H-indazole-3-carbaldehyde (CAS: 677702-36-2) typically synthesized?

Answer

5-Nitro-1H-indazole-3-carbaldehyde
5-Nitro-1H-indazole-3-carbaldehyde can be synthesized via nitration of 1H-indazole-3-carbaldehyde. Nitration is performed using nitric acid and sulfuric acid as the nitrating agent under controlled conditions to ensure selectivity towards the 3-position. The yield is generally around 75-85%, and the use of appropriate catalysts can enhance the reaction rate and selectivity.

About

English Name 5-Nitro-1H-indazole-3-carbaldehyde
Molecular Formula C8H5N3O3
Molecular Weight 191.14 g/mol
SMILES C1=CC2=NNC(=C2C=C1[N+](=O)[O-])C=O
InChIKey UVUPPLXBIXJRKD-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-1H-indazole-3-carbaldehyde (CAS: 677702-36-2)?

5-Nitro-1H-indazole-3-carbaldehyde is a white to off-white solid with a high melting point of 241-24...

Compound Q&A

What industries use 5-Nitro-1H-indazole-3-carbaldehyde (CAS: 677702-36-2)?

5-Nitro-1H-indazole-3-carbaldehyde finds applications in various industries, particularly in the pha...

Compound Q&A

What precautions should be taken when handling 5-Nitro-1H-indazole-3-carbaldehyde (CAS: 677702-36-2)?

When handling 5-Nitro-1H-indazole-3-carbaldehyde, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...