Compound Q&A

What are the physical and chemical properties of 5-Nitro-1H-indazole-3-carbaldehyde (CAS: 677702-36-2)?

Answer

5-Nitro-1H-indazole-3-carbaldehyde
5-Nitro-1H-indazole-3-carbaldehyde is a white to off-white solid with a high melting point of 241-243°C. Its molecular weight is approximately 228.12 g/mol. This compound is poorly soluble in water but soluble in organic solvents like ethanol and acetone. It shows moderate reactivity with reducing agents and is less reactive with bases. It is a Lewis acid and can act as a electrophilic entity in various chemical reactions.

About

English Name 5-Nitro-1H-indazole-3-carbaldehyde
Molecular Formula C8H5N3O3
Molecular Weight 191.14 g/mol
SMILES C1=CC2=NNC(=C2C=C1[N+](=O)[O-])C=O
InChIKey UVUPPLXBIXJRKD-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 5-Nitro-1H-indazole-3-carbaldehyde (CAS: 677702-36-2) typically synthesized?

5-Nitro-1H-indazole-3-carbaldehyde can be synthesized via nitration of 1H-indazole-3-carbaldehyde. N...

Compound Q&A

What industries use 5-Nitro-1H-indazole-3-carbaldehyde (CAS: 677702-36-2)?

5-Nitro-1H-indazole-3-carbaldehyde finds applications in various industries, particularly in the pha...

Compound Q&A

What precautions should be taken when handling 5-Nitro-1H-indazole-3-carbaldehyde (CAS: 677702-36-2)?

When handling 5-Nitro-1H-indazole-3-carbaldehyde, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...