Compound Q&A

What are the main uses of 3-Amino-7-(methylamino)phenothiazin-5-ium chloride (CAS: 531-57-7)?

Answer

3-Amino-7-(methylamino)phenothiazin-5-ium chloride
3-Amino-7-(methylamino)phenothiazin-5-ium chloride is primarily used in pharmaceuticals for its potential as an intermediate in the synthesis of other compounds. It is also utilized in research for its chemical and biological properties.

About

CAS No 531-57-7
English Name 3-Amino-7-(methylamino)phenothiazin-5-ium chloride
Molecular Formula C13H12ClN3S
Molecular Weight 277.77 g/mol
SMILES CN=C1C=CC2=[NH+]C3=C(C=C(C=C3)N)SC2=C1.[Cl-]
InChIKey OBKVLZKRUVYQNQ-UHFFFAOYSA-M
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is 3-Amino-7-(methylamino)phenothiazin-5-ium chloride (CAS: 531-57-7)?

3-Amino-7-(methylamino)phenothiazin-5-ium chloride is a chemical compound with the CAS number 531-57...

Compound Q&A

Is 3-Amino-7-(methylamino)phenothiazin-5-ium chloride (CAS: 531-57-7) safe?

3-Amino-7-(methylamino)phenothiazin-5-ium chloride is generally considered safe when used under appr...

Compound Q&A

How should 3-Amino-7-(methylamino)phenothiazin-5-ium chloride (CAS: 531-57-7) be stored?

3-Amino-7-(methylamino)phenothiazin-5-ium chloride should be stored in a cool, dry place away from h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...