Compound Q&A

What is 3-Amino-7-(methylamino)phenothiazin-5-ium chloride (CAS: 531-57-7)?

Answer

3-Amino-7-(methylamino)phenothiazin-5-ium chloride
3-Amino-7-(methylamino)phenothiazin-5-ium chloride is a chemical compound with the CAS number 531-57-7. It is a yellow solid with a molecular weight of approximately 302.33 g/mol. This compound is known for its potential applications in pharmaceuticals and research due to its unique chemical structure.

About

CAS No 531-57-7
English Name 3-Amino-7-(methylamino)phenothiazin-5-ium chloride
Molecular Formula C13H12ClN3S
Molecular Weight 277.77 g/mol
SMILES CN=C1C=CC2=[NH+]C3=C(C=C(C=C3)N)SC2=C1.[Cl-]
InChIKey OBKVLZKRUVYQNQ-UHFFFAOYSA-M
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What are the main uses of 3-Amino-7-(methylamino)phenothiazin-5-ium chloride (CAS: 531-57-7)?

3-Amino-7-(methylamino)phenothiazin-5-ium chloride is primarily used in pharmaceuticals for its pote...

Compound Q&A

Is 3-Amino-7-(methylamino)phenothiazin-5-ium chloride (CAS: 531-57-7) safe?

3-Amino-7-(methylamino)phenothiazin-5-ium chloride is generally considered safe when used under appr...

Compound Q&A

How should 3-Amino-7-(methylamino)phenothiazin-5-ium chloride (CAS: 531-57-7) be stored?

3-Amino-7-(methylamino)phenothiazin-5-ium chloride should be stored in a cool, dry place away from h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...