Compound Q&A

How should Ligupurpuroside B (CAS: 147396-02-9) be stored?

Answer

Ligupurpuroside B
Ligupurpuroside B (CAS: 147396-02-9) should be stored in a cool, dry place away from direct sunlight and moisture. It is best kept in tightly sealed containers to protect it from air and light exposure. The optimal storage temperature is between 15-25°C (59-77°F).

About

English Name Ligupurpuroside B
Molecular Formula C35H46O17
Molecular Weight 738.7 g/mol
SMILES CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(C(OC(C3OC(=O)C=CC4=CC=C(C=C4)O)CO)OCCC5=CC=C(C=C5)O)O)C)O)O)O
InChIKey FNUMFJHHCJMAHD-CJEBOOSQSA-N
Last Updated: 2025-10-30 11:43

Related Q&A

Compound Q&A

What is Ligupurpuroside B (CAS: 147396-02-9)?

Ligupurpuroside B (CAS: 147396-02-9) is a flavonol glycoside found in certain plants, known for its ...

Compound Q&A

What are the main uses of Ligupurpuroside B (CAS: 147396-02-9)?

Ligupurpuroside B (CAS: 147396-02-9) is primarily used in pharmaceuticals for its potential antioxid...

Compound Q&A

Is Ligupurpuroside B (CAS: 147396-02-9) safe?

Ligupurpuroside B (CAS: 147396-02-9) is generally considered safe when used appropriately. However, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...