Compound Q&A

Is Ligupurpuroside B (CAS: 147396-02-9) safe?

Answer

Ligupurpuroside B
Ligupurpuroside B (CAS: 147396-02-9) is generally considered safe when used appropriately. However, as with any compound, precautions should be taken to avoid skin contact and inhalation. Protective measures include wearing gloves and masks during handling and ensuring proper ventilation.

About

English Name Ligupurpuroside B
Molecular Formula C35H46O17
Molecular Weight 738.7 g/mol
SMILES CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(C(OC(C3OC(=O)C=CC4=CC=C(C=C4)O)CO)OCCC5=CC=C(C=C5)O)O)C)O)O)O
InChIKey FNUMFJHHCJMAHD-CJEBOOSQSA-N
Last Updated: 2025-10-30 11:43

Related Q&A

Compound Q&A

What is Ligupurpuroside B (CAS: 147396-02-9)?

Ligupurpuroside B (CAS: 147396-02-9) is a flavonol glycoside found in certain plants, known for its ...

Compound Q&A

What are the main uses of Ligupurpuroside B (CAS: 147396-02-9)?

Ligupurpuroside B (CAS: 147396-02-9) is primarily used in pharmaceuticals for its potential antioxid...

Compound Q&A

How should Ligupurpuroside B (CAS: 147396-02-9) be stored?

Ligupurpuroside B (CAS: 147396-02-9) should be stored in a cool, dry place away from direct sunlight...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...