Compound Q&A

How should 5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) be stored?

Answer

5-Bromo-2-chlorobenzenesulfonyl chloride
5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent exposure to moisture and air. Proper ventilation is essential during handling to avoid inhalation risks.

About

CAS No 81226-68-8
English Name 5-Bromo-2-chlorobenzenesulfonyl chloride
Molecular Formula C6H3BrCl2O2S
Molecular Weight 289.97 g/mol
SMILES Brc1ccc(c(c1)S(=O)(=O)Cl)Cl
InChIKey QWVGJTXXYAIKIB-UHFFFAOYSA-N
Last Updated: 2025-10-30 11:43

Related Q&A

Compound Q&A

What is 5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8)?

5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) is a chemical compound with the molecular...

Compound Q&A

What are the main uses of 5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8)?

5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) is primarily used as an intermediate in t...

Compound Q&A

Is 5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) safe?

5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) requires caution due to its chemical natu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...