Compound Q&A

What are the main uses of 5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8)?

Answer

5-Bromo-2-chlorobenzenesulfonyl chloride
5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) is primarily used as an intermediate in the synthesis of pharmaceuticals, dyes, and other organic compounds. It is also valuable in research for preparing derivatives and compounds with specific substituents.

About

CAS No 81226-68-8
English Name 5-Bromo-2-chlorobenzenesulfonyl chloride
Molecular Formula C6H3BrCl2O2S
Molecular Weight 289.97 g/mol
SMILES Brc1ccc(c(c1)S(=O)(=O)Cl)Cl
InChIKey QWVGJTXXYAIKIB-UHFFFAOYSA-N
Last Updated: 2025-10-30 11:43

Related Q&A

Compound Q&A

What is 5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8)?

5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) is a chemical compound with the molecular...

Compound Q&A

Is 5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) safe?

5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) requires caution due to its chemical natu...

Compound Q&A

How should 5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) be stored?

5-Bromo-2-chlorobenzenesulfonyl chloride (CAS: 81226-68-8) should be stored in a cool, dry place, aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...