Compound Q&A

What are the physical and chemical properties of Methyl 3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 79128-68-0)?

Answer

Methyl 3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate
Methyl 3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate is a crystalline solid with a molecular weight of approximately 337.08 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and dimethylformamide. The compound is known for its reactivity, particularly towards nucleophiles due to the presence of the trifluoroacetyl group.

About

CAS No 79128-68-0
English Name Methyl 3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate
Molecular Formula C8H6F3NO3S
Molecular Weight 253.2 g/mol
SMILES COC(=O)C1=C(C=CS1)NC(=O)C(F)(F)F
InChIKey CJNCTQZMIQZVQQ-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Methyl 3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 79128-68-0) typically synthesized?

Methyl 3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate is synthesized through a multi-step process...

Compound Q&A

What industries use Methyl 3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 79128-68-0)?

Methyl 3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate finds applications in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling Methyl 3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate (CAS: 79128-68-0)?

When handling Methyl 3-[(trifluoroacetyl)amino]-2-thiophenecarboxylate, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...