Compound Q&A

What industries use 7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1)?

Answer

7-Bromo-5-nitro-1H-indole
7-Bromo-5-nitro-1H-indole is used in the pharmaceutical industry for the synthesis of potential drug candidates. It is also relevant in research for the development of sensors and semiconductors where specific molecular structures are required. Its applications in polymer chemistry and as a precursor for advanced materials are also being explored.

About

CAS No 87240-07-1
English Name 7-Bromo-5-nitro-1H-indole
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES O=[N+](C1=CC2=C(NC=C2)C(Br)=C1)[O-]
InChIKey XXJOZTUJVYCOMP-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1)?

7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1) is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1) typically synthesized?

7-Bromo-5-nitro-1H-indole is typically synthesized via the nitration of indole followed by brominati...

Compound Q&A

What precautions should be taken when handling 7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1)?

When handling 7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1), it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...