Compound Q&A

How is 7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1) typically synthesized?

Answer

7-Bromo-5-nitro-1H-indole
7-Bromo-5-nitro-1H-indole is typically synthesized via the nitration of indole followed by bromination. Common methods involve using nitric acid and sulfuric acid as the nitration reagents, and bromine in the presence of a base like sodium hydroxide for bromination. The overall yield is moderate, and selective functionalization is achieved through careful control of reaction conditions.

About

CAS No 87240-07-1
English Name 7-Bromo-5-nitro-1H-indole
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES O=[N+](C1=CC2=C(NC=C2)C(Br)=C1)[O-]
InChIKey XXJOZTUJVYCOMP-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1)?

7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1) is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1)?

7-Bromo-5-nitro-1H-indole is used in the pharmaceutical industry for the synthesis of potential drug...

Compound Q&A

What precautions should be taken when handling 7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1)?

When handling 7-Bromo-5-nitro-1H-indole (CAS: 87240-07-1), it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...