Compound Q&A

What are the physical and chemical properties of Erythromycin Lactobionate (CAS: 3847-29-8)?

Answer

Erythromycin Lactobionate
Erythromycin Lactobionate is a semi-synthetic macrolide antibiotic. It has a crystalline form and a molecular weight of approximately 1144.44 g/mol. This compound is poorly soluble in water but soluble in dilute acid. It reacts with certain reagents like acids and bases, making it prone to degradation under harsh conditions.

About

CAS No 3847-29-8
English Name Erythromycin Lactobionate
Molecular Formula C49H89NO25
Molecular Weight 1060.19 g/mol
SMILES CCC1C(C(C(C(=O)C(CC(C(C(C(C(C(=O)O1)C)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)O)C)C)O)(C)O.C(C1C(C(C(C(O1)OC(C(CO)O)C(C(C(=O)O)O)O)O)O)O)O
InChIKey YXXKEZBSEDYUNG-RZSKHZPISA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Erythromycin Lactobionate (CAS: 3847-29-8) typically synthesized?

Erythromycin Lactobionate is typically synthesized by reacting Erythromycin with calcium lactate. Co...

Compound Q&A

What industries use Erythromycin Lactobionate (CAS: 3847-29-8)?

Erythromycin Lactobionate is primarily used in the pharmaceutical industry for its antibiotic proper...

Compound Q&A

What precautions should be taken when handling Erythromycin Lactobionate (CAS: 3847-29-8)?

When handling Erythromycin Lactobionate, it is essential to use proper personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...