Compound Q&A

What precautions should be taken when handling Precyclemone B (CAS: 52474-60-9)?

Answer

Precyclemone B
When handling Precyclemone B (CAS: 52474-60-9), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbents and disposed of according to local regulations. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 52474-60-9
English Name Precyclemone B
Molecular Formula C14H22O
Molecular Weight 206.32 g/mol
SMILES O=CC1(C)CCC=C(C1)CCC=C(C)C
InChIKey MBVBLQFHVRGNLW-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Precyclemone B (CAS: 52474-60-9)?

Precyclemone B (CAS: 52474-60-9) is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is Precyclemone B (CAS: 52474-60-9) typically synthesized?

Precyclemone B (CAS: 52474-60-9) can be synthesized via a modified total synthesis route involving m...

Compound Q&A

What industries use Precyclemone B (CAS: 52474-60-9)?

Precyclemone B (CAS: 52474-60-9) is used in pharmaceutical research for its potential biological act...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...