Compound Q&A

How is Precyclemone B (CAS: 52474-60-9) typically synthesized?

Answer

Precyclemone B
Precyclemone B (CAS: 52474-60-9) can be synthesized via a modified total synthesis route involving multiple steps, including silylation, oxidation, and ring closure. The synthesis typically requires a catalyst like palladium(II) acetate and a ligand such as XPhos. The total yield is around 20%, with good selectivity towards the desired product.

About

CAS No 52474-60-9
English Name Precyclemone B
Molecular Formula C14H22O
Molecular Weight 206.32 g/mol
SMILES O=CC1(C)CCC=C(C1)CCC=C(C)C
InChIKey MBVBLQFHVRGNLW-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Precyclemone B (CAS: 52474-60-9)?

Precyclemone B (CAS: 52474-60-9) is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

What industries use Precyclemone B (CAS: 52474-60-9)?

Precyclemone B (CAS: 52474-60-9) is used in pharmaceutical research for its potential biological act...

Compound Q&A

What precautions should be taken when handling Precyclemone B (CAS: 52474-60-9)?

When handling Precyclemone B (CAS: 52474-60-9), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...