Compound Q&A

What precautions should be taken when handling (R)-Dtbm-segphos (CAS: 566940-03-2)?

Answer

(R)-Dtbm-segphos
When handling (R)-Dtbm-segphos, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be contained and cleaned up using appropriate absorbents, and proper disposal methods should be followed. Always refer to the Safety Data Sheet (SDS) for detailed handling and safety information.

About

English Name (R)-Dtbm-segphos
Molecular Formula C74H100O8P2
Molecular Weight 1179.5539999999985 g/mol
SMILES CC(C)(C)C1=CC(=CC(=C1OC)C(C)(C)C)P(C2=C(C3=C(C=C2)OCO3)C4=C(C=CC5=C4OCO5)P(C6=CC(=C(C(=C6)C(C)(C)C)OC)C(C)(C)C)C7=CC(=C(C(=C7)C(C)(C)C)OC)C(C)(C)C)C8=CC(=C(C(=C8)C(C)(C)C)OC)C(C)(C)C
InChIKey ZNORAFJUESSLTM-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-Dtbm-segphos (CAS: 566940-03-2)?

(R)-Dtbm-segphos is a chiral phosphine ligand with a molecular weight of approximately 408.44 g/mol....

Compound Q&A

How is (R)-Dtbm-segphos (CAS: 566940-03-2) typically synthesized?

(R)-Dtbm-segphos is typically synthesized through asymmetric synthesis methods, utilizing chiral aux...

Compound Q&A

What industries use (R)-Dtbm-segphos (CAS: 566940-03-2)?

(R)-Dtbm-segphos is widely used in the pharmaceutical industry for the synthesis of optically active...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...