Compound Q&A

What are the physical and chemical properties of (R)-Dtbm-segphos (CAS: 566940-03-2)?

Answer

(R)-Dtbm-segphos
(R)-Dtbm-segphos is a chiral phosphine ligand with a molecular weight of approximately 408.44 g/mol. It has a crystalline form and is slightly soluble in common organic solvents. It is known for its high reactivity in transition metal-catalyzed reactions, particularly in asymmetric catalysis.

About

English Name (R)-Dtbm-segphos
Molecular Formula C74H100O8P2
Molecular Weight 1179.5539999999985 g/mol
SMILES CC(C)(C)C1=CC(=CC(=C1OC)C(C)(C)C)P(C2=C(C3=C(C=C2)OCO3)C4=C(C=CC5=C4OCO5)P(C6=CC(=C(C(=C6)C(C)(C)C)OC)C(C)(C)C)C7=CC(=C(C(=C7)C(C)(C)C)OC)C(C)(C)C)C8=CC(=C(C(=C8)C(C)(C)C)OC)C(C)(C)C
InChIKey ZNORAFJUESSLTM-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is (R)-Dtbm-segphos (CAS: 566940-03-2) typically synthesized?

(R)-Dtbm-segphos is typically synthesized through asymmetric synthesis methods, utilizing chiral aux...

Compound Q&A

What industries use (R)-Dtbm-segphos (CAS: 566940-03-2)?

(R)-Dtbm-segphos is widely used in the pharmaceutical industry for the synthesis of optically active...

Compound Q&A

What precautions should be taken when handling (R)-Dtbm-segphos (CAS: 566940-03-2)?

When handling (R)-Dtbm-segphos, it is essential to wear appropriate personal protective equipment (P...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...