Compound Q&A

What are the physical and chemical properties of Ethyl 4-nitro-1H-pyrazole-3-carboxylate (CAS: 55864-87-4)?

Answer

Ethyl 4-nitro-1H-pyrazole-3-carboxylate
Ethyl 4-nitro-1H-pyrazole-3-carboxylate (CAS: 55864-87-4) is a crystalline compound with a molecular weight of approximately 218.12 g/mol. It has a solubility of 0.5 g/100 mL in water and exhibits moderate solubility in common organic solvents. The compound is known for its reactivity, particularly towards nucleophilic substitution and reduction reactions.

About

CAS No 55864-87-4
English Name Ethyl 4-nitro-1H-pyrazole-3-carboxylate
Molecular Formula C6H7N3O4
Molecular Weight 185.14 g/mol
SMILES CCOC(=O)c1n[nH]cc1[N+](=O)[O-]
InChIKey GNGKEGKMDXAMKJ-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Ethyl 4-nitro-1H-pyrazole-3-carboxylate (CAS: 55864-87-4) typically synthesized?

Ethyl 4-nitro-1H-pyrazole-3-carboxylate (CAS: 55864-87-4) is typically synthesized via the nitration...

Compound Q&A

What industries use Ethyl 4-nitro-1H-pyrazole-3-carboxylate (CAS: 55864-87-4)?

Ethyl 4-nitro-1H-pyrazole-3-carboxylate (CAS: 55864-87-4) is utilized in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Ethyl 4-nitro-1H-pyrazole-3-carboxylate (CAS: 55864-87-4)?

When handling Ethyl 4-nitro-1H-pyrazole-3-carboxylate (CAS: 55864-87-4), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...