Compound Q&A

What precautions should be taken when handling 4-Chloro-3-(2-pyridinyl)aniline (CAS: 879088-41-2)?

Answer

4-Chloro-3-(2-pyridinyl)aniline
Proper handling of 4-Chloro-3-(2-pyridinyl)aniline requires the use of personal protective equipment (PPE) such as gloves, safety goggles, and lab coats. Work should be conducted in a well-ventilated area or a fume hood. Spills should be immediately contained and managed according to the Material Safety Data Sheet (MSDS). Always follow laboratory safety protocols and ensure proper storage in a cool, dry place away from direct sunlight.

About

English Name 4-Chloro-3-(2-pyridinyl)aniline
Molecular Formula C11H9ClN2
Molecular Weight 204.66 g/mol
SMILES NC1=CC=C(Cl)C(C2=NC=CC=C2)=C1
InChIKey QWVLHTCIAZPQAY-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-3-(2-pyridinyl)aniline (CAS: 879088-41-2)?

4-Chloro-3-(2-pyridinyl)aniline is a crystalline compound with a molecular weight of approximately 2...

Compound Q&A

How is 4-Chloro-3-(2-pyridinyl)aniline (CAS: 879088-41-2) typically synthesized?

4-Chloro-3-(2-pyridinyl)aniline is typically synthesized via a multistep process involving the react...

Compound Q&A

What industries use 4-Chloro-3-(2-pyridinyl)aniline (CAS: 879088-41-2)?

4-Chloro-3-(2-pyridinyl)aniline is used in various industries, including pharmaceuticals, where it s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...